Online Database of Chemicals from Around the World
|
CAS#: 84656-76-8 Product: (1r,1's,4r,4'S)-4-(4-Ethylphenyl)-4'-propyl-1,1'-bi(cyclohexyl) No suppilers available for the product. |
| Name | (1r,1's,4r,4'S)-4-(4-Ethylphenyl)-4'-propyl-1,1'-bi(cyclohexyl) |
|---|---|
| Synonyms | trans,trans-4'-(4-Ethyl-phenyl)-4-propyl-bicyclohexyl |
| Molecular Structure |  |
| Molecular Formula | C23H36 |
| Molecular Weight | 312.53 |
| CAS Registry Number | 84656-76-8 |
| SMILES | CCc1ccc(cc1)[C@H]2CC[C@@H](CC2)[C@@H]3CC[C@H](CC3)CCC |
| InChI | 1S/C23H36/c1-3-5-19-8-12-21(13-9-19)23-16-14-22(15-17-23)20-10-6-18(4-2)7-11-20/h6-7,10-11,19,21-23H,3-5,8-9,12-17H2,1-2H3/t19-,21-,22-,23- |
| InChIKey | PNEGGJHLXGCZNS-GUJRETQESA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.426°C at 760 mmHg (Cal.) |
| Flash point | 206.083°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1r,1's,4r,4'S)-4-(4-Ethylphenyl)-4'-propyl-1,1'-bi(cyclohexyl) |