Online Database of Chemicals from Around the World
|
CAS#: 84682-16-6 Product: 3,4,5,6-Tetramethylocta-3,5-Dien-2-One No suppilers available for the product. |
| Name | 3,4,5,6-Tetramethylocta-3,5-Dien-2-One |
|---|---|
| Synonyms | 3,4,5,6-Tetramethylocta-3,5-Dien-2-One |
| Molecular Structure |  |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 |
| CAS Registry Number | 84682-16-6 |
| EINECS | 283-577-3 |
| SMILES | C(\C(=C(\C(=C(C(=O)C)/C)C)C)C)C |
| InChI | 1S/C12H20O/c1-7-8(2)9(3)10(4)11(5)12(6)13/h7H2,1-6H3/b9-8+,11-10+ |
| InChIKey | FRZSBCAQKUEFDA-BNFZFUHLSA-N |
| Density | 0.858g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.634°C at 760 mmHg (Cal.) |
| Flash point | 116.112°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4,5,6-Tetramethylocta-3,5-Dien-2-One |