Online Database of Chemicals from Around the World
|
CAS#: 84682-30-4 Product: 3-Chloro-2-(Chloromethyl)Cinnamaldehyde No suppilers available for the product. |
| Name | 3-Chloro-2-(Chloromethyl)Cinnamaldehyde |
|---|---|
| Synonyms | (E)-3-[3-Chloro-2-(Chloromethyl)Phenyl]Acrolein; 3-Chloro-2-(Chloromethyl)Cinnamaldehyde |
| Molecular Structure |  |
| Molecular Formula | C10H8Cl2O |
| Molecular Weight | 215.08 |
| CAS Registry Number | 84682-30-4 |
| EINECS | 283-593-0 |
| SMILES | C1=C(Cl)C(=C(\C=C\C=O)C=C1)CCl |
| InChI | 1S/C10H8Cl2O/c11-7-9-8(4-2-6-13)3-1-5-10(9)12/h1-6H,7H2/b4-2+ |
| InChIKey | OEZPPHLWIPFGIL-DUXPYHPUSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.19°C at 760 mmHg (Cal.) |
| Flash point | 148.319°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-2-(Chloromethyl)Cinnamaldehyde |