|
CAS#: 84696-91-3 Product: butane, 3-hydroxy-3-oxo-2-[2-sulfo-5-(trifluoromethyl)phenyl]azo-propanoate No suppilers available for the product. |
| Name | butane, 3-hydroxy-3-oxo-2-[2-sulfo-5-(trifluoromethyl)phenyl]azo-propanoate |
|---|---|
| Synonyms | diethyl h |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16F3N2O7S |
| Molecular Weight | 413.35 |
| CAS Registry Number | 84696-91-3 |
| EINECS | 283-699-7 |
| SMILES | CCCC.[O-]C(=O)C(N=Nc1cc(ccc1S(O)(=O)=O)C(F)(F)F)C(O)=O |
| InChI | 1S/C10H7F3N2O7S.C4H10/c11-10(12,13)4-1-2-6(23(20,21)22)5(3-4)14-15-7(8(16)17)9(18)19;1-3-4-2/h1-3,7H,(H,16,17)(H,18,19)(H,20,21,22);3-4H2,1-2H3/p-1 |
| InChIKey | HSOWKPKVUYQQJV-UHFFFAOYSA-M |
| Boiling point | 560.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 292.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for butane, 3-hydroxy-3-oxo-2-[2-sulfo-5-(trifluoromethyl)phenyl]azo-propanoate |