Online Database of Chemicals from Around the World
|
CAS#: 84744-41-2 Product: Dihydroheptaprenyl Phosphate No suppilers available for the product. |
| Name | Dihydroheptaprenyl Phosphate |
|---|---|
| Synonyms | 6,10,14,18,22,26-Octacosahexaen-1-Ol, 3,7,11,15,19,23,27-Heptamethyl-, Dihydrogen Phosphate, (All-E)-; Dhhpp; Dihydroheptaprenyl Phosphate |
| Molecular Structure |  |
| Molecular Formula | C35H61O4P |
| Molecular Weight | 576.84 |
| CAS Registry Number | 84744-41-2 |
| SMILES | C(O[P](=O)(O)O)CC(CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CC/C=C(/CCC=C(C)C)C)C)C)C)C)C |
| InChI | 1S/C35H61O4P/c1-29(2)15-9-16-30(3)17-10-18-31(4)19-11-20-32(5)21-12-22-33(6)23-13-24-34(7)25-14-26-35(8)27-28-39-40(36,37)38/h15,17,19,21,23,25,35H,9-14,16,18,20,22,24,26-28H2,1-8H3,(H2,36,37,38)/b30-17+,31-19+,32-21+,33-23+,34-25+ |
| InChIKey | VQBIXOYUJCMBFR-HOWIICQTSA-N |
| Density | 0.973g/cm3 (Cal.) |
|---|---|
| Boiling point | 658.888°C at 760 mmHg (Cal.) |
| Flash point | 352.283°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dihydroheptaprenyl Phosphate |