Online Database of Chemicals from Around the World
|
CAS#: 84745-01-7 Product: Sarubicin B No suppilers available for the product. |
| Name | Sarubicin B |
|---|---|
| Synonyms | 5-Acetyl-3-Amino-1,4-Dioxo-Naphthalene-2-Carboxamide; 5-Acetyl-3-Amino-1,4-Dioxo-2-Naphthalenecarboxamide; 5-Acetyl-3-Amino-1,4-Diketo-2-Naphthamide |
| Molecular Structure |  |
| Molecular Formula | C13H10N2O4 |
| Molecular Weight | 258.23 |
| CAS Registry Number | 84745-01-7 |
| SMILES | C2=C1C(C(=C(C(C1=C(C(=O)C)C=C2)=O)N)C(=O)N)=O |
| InChI | 1S/C13H10N2O4/c1-5(16)6-3-2-4-7-8(6)12(18)10(14)9(11(7)17)13(15)19/h2-4H,14H2,1H3,(H2,15,19) |
| InChIKey | GEZOTJVKGITFJU-UHFFFAOYSA-N |
| Density | 1.467g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.635°C at 760 mmHg (Cal.) |
| Flash point | 280.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sarubicin B |