Online Database of Chemicals from Around the World
|
CAS#: 84825-00-3 Product: 4-Chloro-6-Nitro-o-Cresyl Acetate No suppilers available for the product. |
| Name | 4-Chloro-6-Nitro-o-Cresyl Acetate |
|---|---|
| Synonyms | (4-Chloro-2-Methyl-6-Nitro-Phenyl) Acetate; Acetic Acid (4-Chloro-2-Methyl-6-Nitrophenyl) Ester; Acetic Acid (4-Chloro-2-Methyl-6-Nitro-Phenyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C9H8ClNO4 |
| Molecular Weight | 229.62 |
| CAS Registry Number | 84825-00-3 |
| EINECS | 284-253-4 |
| SMILES | C1=C([N+]([O-])=O)C(=C(C=C1Cl)C)OC(=O)C |
| InChI | 1S/C9H8ClNO4/c1-5-3-7(10)4-8(11(13)14)9(5)15-6(2)12/h3-4H,1-2H3 |
| InChIKey | AJFVBBYSZQVCNK-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 328.871°C at 760 mmHg (Cal.) |
| Flash point | 152.696°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-6-Nitro-o-Cresyl Acetate |