Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | trans-4-sec-Butylcyclohexanecarbonyl chloride |
|---|---|
| Synonyms | (1r,4r)-4-(sec-butyl)cyclohexanecarbonyl chloride |
| Molecular Structure |  |
| Molecular Formula | C11H19ClO |
| Molecular Weight | 202.72 |
| CAS Registry Number | 84865-84-9 |
| SMILES | CCC([C@H]1CC[C@@H](CC1)C(=O)Cl)C |
| InChI | 1S/C11H19ClO/c1-3-8(2)9-4-6-10(7-5-9)11(12)13/h8-10H,3-7H2,1-2H3/t8?,9-,10- |
| InChIKey | ZWIPVUGICGZIAU-PHAYGUFNSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 247.4±9.0°C at 760 mmHg (Cal.) |
| Flash point | 132.3±8.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-4-sec-Butylcyclohexanecarbonyl chloride |