Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 1-(2,2-Dibromovinyl)-2,3,4-trimethoxybenzene |
|---|---|
| Synonyms | Benzene, 1-(2,2-dibromoethenyl)-2,3,4-trimethoxy- |
| Molecular Structure |  |
| Molecular Formula | C11H12Br2O3 |
| Molecular Weight | 352.02 |
| CAS Registry Number | 849186-15-8 |
| SMILES | COc1c(OC)c(ccc1OC)\C=C(/Br)Br |
| InChI | 1S/C11H12Br2O3/c1-14-8-5-4-7(6-9(12)13)10(15-2)11(8)16-3/h4-6H,1-3H3 |
| InChIKey | PYJAJWUSAKNLBW-UHFFFAOYSA-N |
| Density | 1.66g/cm3 (Cal.) |
|---|---|
| Boiling point | 373.56°C at 760 mmHg (Cal.) |
| Flash point | 153.12°C (Cal.) |
| Refractive index | 1.603 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2,2-Dibromovinyl)-2,3,4-trimethoxybenzene |