|
CAS#: 84946-21-4 Product: N-(2-Chloroethyl)-2-Nitrobenzamide No suppilers available for the product. |
| Name | N-(2-Chloroethyl)-2-Nitrobenzamide |
|---|---|
| Synonyms | N-(2-Chloroethyl)-2-Nitro-Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63 |
| CAS Registry Number | 84946-21-4 |
| EINECS | 284-625-6 |
| SMILES | C1=CC=CC(=C1C(=O)NCCCl)[N+]([O-])=O |
| InChI | 1S/C9H9ClN2O3/c10-5-6-11-9(13)7-3-1-2-4-8(7)12(14)15/h1-4H,5-6H2,(H,11,13) |
| InChIKey | JMTMTKFVHPTYCR-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 412.078°C at 760 mmHg (Cal.) |
| Flash point | 203.018°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2-Chloroethyl)-2-Nitrobenzamide |