Online Database of Chemicals from Around the World
|
CAS#: 84963-41-7 Product: 3,11,20-Trioxopregn-4-en-21-yl pivalate No suppilers available for the product. |
| Name | 3,11,20-Trioxopregn-4-en-21-yl pivalate |
|---|---|
| Synonyms | 21-hydroxypregn-4-ene-3,11,20-trione 21-pivalate |
| Molecular Structure |  |
| Molecular Formula | C26H36O5 |
| Molecular Weight | 428.56 |
| CAS Registry Number | 84963-41-7 |
| EINECS | 284-844-7 |
| SMILES | CC(C)(C)C(=O)OCC(=O)[C@H]3CC[C@H]4[C@@H]2CCC1=CC(=O)CC[C@]1(C)[C@H]2C(=O)C[C@]34C |
| InChI | 1S/C26H36O5/c1-24(2,3)23(30)31-14-21(29)19-9-8-18-17-7-6-15-12-16(27)10-11-25(15,4)22(17)20(28)13-26(18,19)5/h12,17-19,22H,6-11,13-14H2,1-5H3/t17-,18-,19+,22+,25-,26-/m0/s1 |
| InChIKey | MFNKUOBOAMIHNU-HEDGWYKQSA-N |
| Density | 1.159g/cm3 (Cal.) |
|---|---|
| Boiling point | 563.418°C at 760 mmHg (Cal.) |
| Flash point | 240.763°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,11,20-Trioxopregn-4-en-21-yl pivalate |