| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Chemical reagent >> Organic reagent >> Phosphine ligand |
|---|---|
| Name | Walphos SL-W022-1 |
| Synonyms | (1S)-1-[(1R)-1-[Bis(bicyclo[2.2.1]hept-2-yl)phosphino]ethyl]-2-[2-(diphenylphosphino)phenyl]ferrocene |
| Molecular Structure | ![]() |
| Molecular Formula | C44H48FeP2 |
| Molecular Weight | 694.64 |
| CAS Registry Number | 849925-29-7 |
| SMILES | CC([C]1[CH][CH][CH][C]1C2=CC=CC=C2P(C3=CC=CC=C3)C4=CC=CC=C4)P(C5CC6CCC5C6)C7CC8CCC7C8.[CH]1[CH][CH][CH][CH]1.[Fe] |
|
Walphos SL-W022-1 is a sophisticated chiral phosphine ligand developed for advanced catalytic applications in asymmetric synthesis. This chemical substance, part of the Walphos family of ligands, plays a crucial role in enhancing the performance of transition metal catalysts in various reactions, notably in asymmetric catalysis. The development of Walphos SL-W022-1 stems from the need for highly efficient and selective chiral ligands that can improve the yield and enantioselectivity of asymmetric transformations. Its structure incorporates unique features that enable it to form stable complexes with transition metals, thereby facilitating precise control over the stereochemistry of the resulting products. One of the primary applications of Walphos SL-W022-1 is in asymmetric hydrogenation. This reaction involves the addition of hydrogen to unsaturated organic compounds, producing chiral alcohols or amines. The ligand's ability to create a chiral environment around the metal center enhances the selectivity of the hydrogenation process, making it possible to synthesize enantiomerically pure products with high efficiency. This application is particularly valuable in the pharmaceutical industry, where the production of chiral intermediates and final drugs requires stringent control over stereochemistry. Walphos SL-W022-1 is also utilized in asymmetric cross-coupling reactions. These reactions are essential for forming carbon-carbon bonds in organic synthesis, allowing chemists to build complex molecules with precise control over their structures. The ligand's effectiveness in stabilizing metal intermediates and guiding the formation of desired products demonstrates its utility in creating intricate organic frameworks. The design of Walphos SL-W022-1 highlights the advancements in ligand development aimed at optimizing catalytic processes. By integrating specific structural elements, this ligand enhances the performance of metal catalysts in asymmetric reactions, offering improvements in both yield and selectivity. Overall, Walphos SL-W022-1 represents a significant advancement in the field of chiral ligands. Its applications in asymmetric hydrogenation and cross-coupling reactions underline its importance in both academic research and industrial chemistry, contributing to the synthesis of high-value chiral compounds. |
| Market Analysis Reports |