Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 5-(Bromomethyl)-Chrysene |
|---|---|
| Synonyms | Chrysene, 5-(Bromomethyl)- |
| Molecular Structure |  |
| Molecular Formula | C19H13Br |
| Molecular Weight | 321.22 |
| CAS Registry Number | 85083-61-0 |
| SMILES | C1=C4C(=CC=C1)C3=C(C2=CC=CC=C2C=C3CBr)C=C4 |
| InChI | 1S/C19H13Br/c20-12-15-11-14-6-2-3-7-16(14)18-10-9-13-5-1-4-8-17(13)19(15)18/h1-11H,12H2 |
| InChIKey | UGKCDSOEXQNEQR-UHFFFAOYSA-N |
| Density | 1.452g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.743°C at 760 mmHg (Cal.) |
| Flash point | 255.148°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Bromomethyl)-Chrysene |