Online Database of Chemicals from Around the World
|
CAS#: 85136-05-6 Product: 4,7-Dimethyl-4-Vinyloct-6-En-3-Ol No suppilers available for the product. |
| Name | 4,7-Dimethyl-4-Vinyloct-6-En-3-Ol |
|---|---|
| Synonyms | 4,7-Dimethyl-4-Vinyl-Oct-6-En-3-Ol; 4,7-Dimethyl-4-Vinyloct-6-En-3-Ol; 4-Ethenyl-4,7-Dimethyl-Oct-6-En-3-Ol |
| Molecular Structure |  |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 85136-05-6 |
| EINECS | 285-727-3 |
| SMILES | C(C)C(C(CC=C(C)C)(C)C=C)O |
| InChI | 1S/C12H22O/c1-6-11(13)12(5,7-2)9-8-10(3)4/h7-8,11,13H,2,6,9H2,1,3-5H3 |
| InChIKey | BLLRZXYXUWMGHJ-UHFFFAOYSA-N |
| Density | 0.856g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.57°C at 760 mmHg (Cal.) |
| Flash point | 93.158°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dimethyl-4-Vinyloct-6-En-3-Ol |