Online Database of Chemicals from Around the World
|
CAS#: 85136-69-2 Product: 1-Bromo-2-iodonaphtho[7,8,1,2,3-nopqr]tetraphene-6,12-dione No suppilers available for the product. |
| Name | 1-Bromo-2-iodonaphtho[7,8,1,2,3-nopqr]tetraphene-6,12-dione |
|---|---|
| Synonyms | bromoiododibenzo[def,mno]chrysene-6,12-dione |
| Molecular Structure | ![CAS#: 85136-69-2， 1-Bromo-2-iodonaphtho[7,8,1,2,3-nopqr]tetraphene-6,12-dione](/moreStructures/85136-69-2.gif) |
| Molecular Formula | C22H8BrIO2 |
| Molecular Weight | 511.11 |
| CAS Registry Number | 85136-69-2 |
| EINECS | 285-794-9 |
| SMILES | Ic3cc2ccc1C(=O)c5cccc6ccc4c(c1c2c(c3Br)C4=O)c56 |
| InChI | 1S/C22H8BrIO2/c23-20-14(24)8-10-5-7-12-18-16(10)19(20)22(26)13-6-4-9-2-1-3-11(21(12)25)15(9)17(13)18/h1-8H |
| InChIKey | BBRZTHVSFWFFNO-UHFFFAOYSA-N |
| Density | 2.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 708.763°C at 760 mmHg (Cal.) |
| Flash point | 382.447°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Bromo-2-iodonaphtho[7,8,1,2,3-nopqr]tetraphene-6,12-dione |