Online Database of Chemicals from Around the World
|
CAS#: 85153-57-7 Product: 1-Phenylethyl 2,2-Dichloroacetoacetate No suppilers available for the product. |
| Name | 1-Phenylethyl 2,2-Dichloroacetoacetate |
|---|---|
| Synonyms | 1-Phenylethyl 2,2-Dichloro-3-Oxo-Butanoate; 2,2-Dichloro-3-Oxobutanoic Acid 1-Phenylethyl Ester; 2,2-Dichloro-3-Keto-Butyric Acid 1-Phenylethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 |
| CAS Registry Number | 85153-57-7 |
| EINECS | 285-839-2 |
| SMILES | C1=CC=CC=C1C(OC(=O)C(Cl)(Cl)C(=O)C)C |
| InChI | 1S/C12H12Cl2O3/c1-8(10-6-4-3-5-7-10)17-11(16)12(13,14)9(2)15/h3-8H,1-2H3 |
| InChIKey | LRVRGCXZUQMFGR-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.556°C at 760 mmHg (Cal.) |
| Flash point | 121.402°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Phenylethyl 2,2-Dichloroacetoacetate |