Online Database of Chemicals from Around the World
|
CAS#: 85153-82-8 Product: Propyl 5-oxo-L-prolinate No suppilers available for the product. |
| Name | Propyl 5-oxo-L-prolinate |
|---|---|
| Synonyms | propyl 5-oxo-DL-prolinate |
| Molecular Structure |  |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.19 |
| CAS Registry Number | 85153-82-8 |
| EINECS | 285-867-5 |
| SMILES | O=C(OCCC)[C@@H]1CCC(=O)N1 |
| InChI | 1S/C8H13NO3/c1-2-5-12-8(11)6-3-4-7(10)9-6/h6H,2-5H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | BGXWNKLNZHEEMA-LURJTMIESA-N |
| Density | 1.127g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.031°C at 760 mmHg (Cal.) |
| Flash point | 149.164°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Propyl 5-oxo-L-prolinate |