|
CAS#: 852203-12-4 Product: 3-Bromo-1-methyl-4-phenyl-2(1H)-quinolinone No suppilers available for the product. |
| Name | 3-Bromo-1-methyl-4-phenyl-2(1H)-quinolinone |
|---|---|
| Synonyms | 3-Bromo-1-methyl-4-phenyl-1H-2-quinolinone; 3-Bromo-1-methyl-4-phenyl-1H-quinolin-2-one |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12BrNO |
| Molecular Weight | 314.18 |
| CAS Registry Number | 852203-12-4 |
| SMILES | Cn1c2ccccc2c(c(c1=O)Br)c3ccccc3 |
| InChI | 1S/C16H12BrNO/c1-18-13-10-6-5-9-12(13)14(15(17)16(18)19)11-7-3-2-4-8-11/h2-10H,1H3 |
| InChIKey | RZAQUJMLIPTORZ-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.83°C at 760 mmHg (Cal.) |
| Flash point | 190.168°C (Cal.) |
| Refractive index | 1.666 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Bromo-1-methyl-4-phenyl-2(1H)-quinolinone |