Online Database of Chemicals from Around the World
|
CAS#: 85303-98-6 Product: 3-(2-Ethylphenyl)-5-(3-Ethoxyphenyl)-1H-1,2,4-Triazole No suppilers available for the product. |
| Name | 3-(2-Ethylphenyl)-5-(3-Ethoxyphenyl)-1H-1,2,4-Triazole |
|---|---|
| Synonyms | 5-(M-Ethoxyphenyl)-3-(O-Ethylphenyl)-S-Triazole; Brn 5580635; S-Triazole, 5-(M-Ethoxyphenyl)-3-(O-Ethylphenyl)- |
| Molecular Structure |  |
| Molecular Formula | C18H19N3O |
| Molecular Weight | 293.37 |
| CAS Registry Number | 85303-98-6 |
| SMILES | C1=CC=C(C=C1OCC)C2=N[NH]C(=N2)C3=C(C=CC=C3)CC |
| InChI | 1S/C18H19N3O/c1-3-13-8-5-6-11-16(13)18-19-17(20-21-18)14-9-7-10-15(12-14)22-4-2/h5-12H,3-4H2,1-2H3,(H,19,20,21) |
| InChIKey | OQIXMBRLORCZDL-UHFFFAOYSA-N |
| Density | 1.137g/cm3 (Cal.) |
|---|---|
| Boiling point | 509.367°C at 760 mmHg (Cal.) |
| Flash point | 180.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Ethylphenyl)-5-(3-Ethoxyphenyl)-1H-1,2,4-Triazole |