Online Database of Chemicals from Around the World
|
CAS#: 85392-27-4 Product: (2-Chlorophenyl)Methyl 4-Hydroxybenzoate No suppilers available for the product. |
| Name | (2-Chlorophenyl)Methyl 4-Hydroxybenzoate |
|---|---|
| Synonyms | 4-Hydroxybenzoic Acid (2-Chlorophenyl)Methyl Ester; 4-Hydroxybenzoic Acid (2-Chlorobenzyl) Ester |
| Molecular Structure |  |
| Molecular Formula | C14H11ClO3 |
| Molecular Weight | 262.69 |
| CAS Registry Number | 85392-27-4 |
| EINECS | 286-886-1 |
| SMILES | C1=C(O)C=CC(=C1)C(OCC2=C(Cl)C=CC=C2)=O |
| InChI | 1S/C14H11ClO3/c15-13-4-2-1-3-11(13)9-18-14(17)10-5-7-12(16)8-6-10/h1-8,16H,9H2 |
| InChIKey | ZDAAPEPLJTXHQY-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.045°C at 760 mmHg (Cal.) |
| Flash point | 206.022°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2-Chlorophenyl)Methyl 4-Hydroxybenzoate |