| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Biphenyl compounds |
|---|---|
| Name | Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) |
| Synonyms | Chlorogold dicyclohexyl-[2-(2,6-dimethoxyphenyl)phenyl]phosphane |
| Molecular Structure | ![]() |
| Molecular Formula | C26H35AuClO2P |
| Molecular Weight | 642.95 |
| CAS Registry Number | 854045-95-7 |
| EC Number | 695-553-3 |
| SMILES | COC1=C(C(=CC=C1)OC)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4.Cl[Au] |
| Melting Point | 263-266 °C |
|---|---|
| Hazard Symbols | |||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Risk Statements | H315-H319-H335 Details | ||||||||||||||||
| Safety Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
|
Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) is a noteworthy organometallic compound known for its unique structure and valuable applications in catalysis. This gold(I) complex features a distinct ligand system that contributes to its stability and reactivity, making it an important tool in synthetic chemistry. The chemical structure of Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) consists of a gold(I) center coordinated by a bidentate ligand. This ligand, 2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl, combines a biphenyl backbone with two dicyclohexylphosphine groups and two methoxy substituents on the biphenyl ring. The presence of these functional groups imparts both steric and electronic effects that play a crucial role in the compound's catalytic behavior. The discovery of this compound stemmed from efforts to develop gold(I) complexes with enhanced stability and activity for various catalytic processes. The bidentate ligand used in Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) stabilizes the gold center through strong donor interactions, which improves the complex's resistance to decomposition and facilitates its performance in catalysis. The bulky dicyclohexylphosphine groups provide steric protection to the gold center, while the methoxy groups enhance the ligand's electronic properties. One of the primary applications of Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) is in catalytic reactions, particularly in the activation of C-H bonds and the promotion of various bond-forming processes. The gold(I) center in this complex is effective at lowering activation energies and stabilizing reaction intermediates, making it suitable for a range of organic transformations. This includes facilitating carbon-carbon bond formation, oxidation reactions, and selective functionalization of organic molecules. In addition to its catalytic applications, Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) is also used in the synthesis of complex molecules and advanced materials. Its ability to promote selective and efficient chemical transformations is beneficial for the development of pharmaceuticals, agrochemicals, and high-performance materials. The versatility of this gold(I) complex underscores its importance in both academic research and industrial applications. The unique combination of electronic and steric effects provided by the ligand in Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) enhances its reactivity and stability. This makes it a valuable compound in modern synthetic chemistry, where it contributes to the advancement of various chemical processes and the synthesis of complex compounds. References none |
| Market Analysis Reports |
| List of Reports Available for Chloro(2-dicyclohexylphosphino-2',6'-dimethoxy-1,1'-biphenyl)gold(I) |