Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Isopropoxy-4-quinolinecarbonitrile |
|---|---|
| Synonyms | 2-Isopropoxy-4-chinolincarbonitril; 2-Isopropoxy-4-quinoléinecarbonitrile; 2-Isopropoxy-4-quinolinecarbonitrile |
| Molecular Structure |  |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 |
| CAS Registry Number | 855165-21-8 |
| SMILES | CC(C)Oc1cc(c2ccccc2n1)C#N |
| InChI | 1S/C13H12N2O/c1-9(2)16-13-7-10(8-14)11-5-3-4-6-12(11)15-13/h3-7,9H,1-2H3 |
| InChIKey | HMLSROFICROWOJ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 284.4±25.0°C at 760 mmHg (Cal.) |
| Flash point | 125.8±23.2°C (Cal.) |
| Refractive index | 1.597 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropoxy-4-quinolinecarbonitrile |