|
CAS#: 85609-79-6 Product: 8-[(1E)-3,3-Dimethyl-1-triazen-1-yl]-7-ethyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione No suppilers available for the product. |
| Name | 8-[(1E)-3,3-Dimethyl-1-triazen-1-yl]-7-ethyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |
|---|---|
| Synonyms | EDMTP; EDMTP-I; Etheofazine |
| Molecular Structure | ![]() |
| Molecular Formula | C11H17N7O2 |
| Molecular Weight | 279.30 |
| CAS Registry Number | 85609-79-6 |
| SMILES | O=C2N(c1nc(/N=N/N(C)C)n(c1C(=O)N2C)CC)C |
| InChI | 1S/C11H17N7O2/c1-6-18-7-8(12-10(18)13-14-15(2)3)16(4)11(20)17(5)9(7)19/h6H2,1-5H3/b14-13+ |
| InChIKey | OAQSALGVFQVOGT-BUHFOSPRSA-N |
| Density | 1.395g/cm3 (Cal.) |
|---|---|
| Boiling point | 436.729°C at 760 mmHg (Cal.) |
| Flash point | 217.926°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-[(1E)-3,3-Dimethyl-1-triazen-1-yl]-7-ethyl-1,3-dimethyl-3,7-dihydro-1H-purine-2,6-dione |