|
CAS#: 85646-44-2 Product: N-(4-Nitrobenzoyl)-D-glutamic acid No suppilers available for the product. |
| Name | N-(4-Nitrobenzoyl)-D-glutamic acid |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O7 |
| Molecular Weight | 296.23 |
| CAS Registry Number | 85646-44-2 |
| EINECS | 288-049-6 |
| SMILES | O=[N+]([O-])c1ccc(cc1)C(=O)N[C@H](CCC(O)=O)C(O)=O |
| InChI | 1S/C12H12N2O7/c15-10(16)6-5-9(12(18)19)13-11(17)7-1-3-8(4-2-7)14(20)21/h1-4,9H,5-6H2,(H,13,17)(H,15,16)(H,18,19)/t9-/m1/s1 |
| InChIKey | NOJZBJAFCSWMKC-SECBINFHSA-N |
| Density | 1.502g/cm3 (Cal.) |
|---|---|
| Boiling point | 619.874°C at 760 mmHg (Cal.) |
| Flash point | 328.688°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(4-Nitrobenzoyl)-D-glutamic acid |