|
CAS#: 85653-38-9 Product: 3-[(Dimethylarsino)sulfanyl]-D-valine No suppilers available for the product. |
| Name | 3-[(Dimethylarsino)sulfanyl]-D-valine |
|---|---|
| Synonyms | 3-((Dimethylarsino-76As)thio)-D-valine; Dimethylarsinopenicillamine; DMAPA |
| Molecular Structure | ![]() |
| Molecular Formula | C7H16AsNO2S |
| Molecular Weight | 253.19 |
| CAS Registry Number | 85653-38-9 |
| SMILES | O=C(O)[C@H](N)C(S[As](C)C)(C)C |
| InChI | 1S/C7H16AsNO2S/c1-7(2,12-8(3)4)5(9)6(10)11/h5H,9H2,1-4H3,(H,10,11)/t5-/m0/s1 |
| InChIKey | KFYRJJBUHYILSO-YFKPBYRVSA-N |
| Boiling point | 327.294°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 151.742°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(Dimethylarsino)sulfanyl]-D-valine |