Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Fluorochem Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (1457) 860-111 | |||
|
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Name | 7-Iodo-1-benzofuran-5-sulfonyl chloride |
|---|---|
| Synonyms | 5-BENZOFURANSULFONYLCHLORIDE, 7-IODO-; 7-Iodobenzofuran-5-sulfonyl chloride; 7-Iodo-benzofuran-5-sulfonyl chloride |
| Molecular Formula | C8H4ClIO3S |
| Molecular Weight | 342.54 |
| CAS Registry Number | 856678-58-5 |
| SMILES | c1coc2c1cc(cc2I)S(=O)(=O)Cl |
| InChI | 1S/C8H4ClIO3S/c9-14(11,12)6-3-5-1-2-13-8(5)7(10)4-6/h1-4H |
| InChIKey | JRNYAXAKWGEDMF-UHFFFAOYSA-N |
| Density | 2.075g/cm3 (Cal.) |
|---|---|
| Boiling point | 403.969°C at 760 mmHg (Cal.) |
| Flash point | 198.113°C (Cal.) |
| Refractive index | 1.694 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 7-Iodo-1-benzofuran-5-sulfonyl chloride |