Online Database of Chemicals from Around the World
|
CAS#: 85668-74-2 Product: 1,1'-(3-Ethyl-5-methyl-3,4-heptanediyl)bis[4-(2-methyl-2-propanyl)benzene] No suppilers available for the product. |
| Name | 1,1'-(3-Ethyl-5-methyl-3,4-heptanediyl)bis[4-(2-methyl-2-propanyl)benzene] |
|---|---|
| Molecular Structure | ![CAS#: 85668-74-2， 1,1'-(3-Ethyl-5-methyl-3,4-heptanediyl)bis[4-(2-methyl-2-propanyl)benzene]](/moreStructures/85668-74-2.gif) |
| Molecular Formula | C30H46 |
| Molecular Weight | 406.69 |
| CAS Registry Number | 85668-74-2 |
| SMILES | c1cc(ccc1C(C(c2ccc(cc2)C(C)(C)C)C(C)CC)(CC)CC)C(C)(C)C |
| InChI | 1S/C30H46/c1-11-22(4)27(23-14-16-24(17-15-23)28(5,6)7)30(12-2,13-3)26-20-18-25(19-21-26)29(8,9)10/h14-22,27H,11-13H2,1-10H3 |
| InChIKey | WNLBDFYTLIBLQU-UHFFFAOYSA-N |
| Density | 0.903g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.885°C at 760 mmHg (Cal.) |
| Flash point | 268.026°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1'-(3-Ethyl-5-methyl-3,4-heptanediyl)bis[4-(2-methyl-2-propanyl)benzene] |