Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-Chloro-3-nitro-2-pyridinecarboxamide |
|---|---|
| Synonyms | 2-Pyridinecarboxamide, 5-chloro-3-nitro-; 2-PYRIDINECARBOXAMIDE,5-CHLORO-3-NITRO-; 5-Chlor-3-nitro-2-pyridincarboxamid |
| Molecular Structure |  |
| Molecular Formula | C6H4ClN3O3 |
| Molecular Weight | 201.57 |
| CAS Registry Number | 856834-36-1 |
| SMILES | c1c(cnc(c1[N+](=O)[O-])C(=O)N)Cl |
| InChI | 1S/C6H4ClN3O3/c7-3-1-4(10(12)13)5(6(8)11)9-2-3/h1-2H,(H2,8,11) |
| InChIKey | STMVOCILKBZVFG-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.4±42.0°C at 760 mmHg (Cal.) |
| Flash point | 143.3±27.9°C (Cal.) |
| Refractive index | 1.633 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Chloro-3-nitro-2-pyridinecarboxamide |