Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,5-Dichloro-4-pyridinol 1-oxide |
|---|---|
| Synonyms | 3,5-dichloro-4-hydroxypyridine 1-oxide |
| Molecular Structure |  |
| Molecular Formula | C5H3Cl2NO2 |
| Molecular Weight | 179.99 |
| CAS Registry Number | 856965-81-6 |
| SMILES | c1c(c(c(c[n+]1[O-])Cl)O)Cl |
| InChI | 1S/C5H3Cl2NO2/c6-3-1-8(10)2-4(7)5(3)9/h1-2,9H |
| InChIKey | WPDLQBHSUYLARX-UHFFFAOYSA-N |
| Density | 1.661g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.349°C at 760 mmHg (Cal.) |
| Flash point | 175.967°C (Cal.) |
| Refractive index | 1.617 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5-Dichloro-4-pyridinol 1-oxide |