|
CAS#: 85713-14-0 Product: (2R,5S)-5-Amino-2-benzyl-8-[(diaminomethylene)amino]-4-oxooctanoic acid hydrochloride (1:1) No suppilers available for the product. |
| Name | (2R,5S)-5-Amino-2-benzyl-8-[(diaminomethylene)amino]-4-oxooctanoic acid hydrochloride (1:1) |
|---|---|
| Synonyms | 5-Amino-8 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25ClN4O3 |
| Molecular Weight | 356.85 |
| CAS Registry Number | 85713-14-0 |
| SMILES | Cl.O=C([C@@H](N)CCC/N=C(\N)N)C[C@H](C(=O)O)Cc1ccccc1 |
| InChI | 1S/C16H24N4O3.ClH/c17-13(7-4-8-20-16(18)19)14(21)10-12(15(22)23)9-11-5-2-1-3-6-11;/h1-3,5-6,12-13H,4,7-10,17H2,(H,22,23)(H4,18,19,20);1H/t12-,13+;/m1./s1 |
| InChIKey | HMGUILIKOXYYFP-KZCZEQIWSA-N |
| Boiling point | 589.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 310.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2R,5S)-5-Amino-2-benzyl-8-[(diaminomethylene)amino]-4-oxooctanoic acid hydrochloride (1:1) |