Online Database of Chemicals from Around the World
|
CAS#: 85721-02-4 Product: (4-Fluorophenyl)[2-sulfanyl-5-(trifluoromethyl)phenyl]methanone No suppilers available for the product. |
| Name | (4-Fluorophenyl)[2-sulfanyl-5-(trifluoromethyl)phenyl]methanone |
|---|---|
| Synonyms | 4'-fluoro-2-mercapto-5-(trifluoromethyl)benzophenone |
| Molecular Structure | ![CAS#: 85721-02-4， (4-Fluorophenyl)[2-sulfanyl-5-(trifluoromethyl)phenyl]methanone](/moreStructures/85721-02-4.gif) |
| Molecular Formula | C14H8F4OS |
| Molecular Weight | 300.27 |
| CAS Registry Number | 85721-02-4 |
| EINECS | 288-411-3 |
| SMILES | O=C(c1cc(ccc1S)C(F)(F)F)c2ccc(F)cc2 |
| InChI | 1S/C14H8F4OS/c15-10-4-1-8(2-5-10)13(19)11-7-9(14(16,17)18)3-6-12(11)20/h1-7,20H |
| InChIKey | BGLUEAAVFASDSK-UHFFFAOYSA-N |
| Density | 1.378g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.185°C at 760 mmHg (Cal.) |
| Flash point | 192.197°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Fluorophenyl)[2-sulfanyl-5-(trifluoromethyl)phenyl]methanone |