Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Acetamido-N-(chloroacetyl)alanine |
|---|---|
| Synonyms | 2-acetamido-2-(2-chloroacetamido)propanoic acid; NSC203456 |
| Molecular Structure |  |
| Molecular Formula | C7H11ClN2O4 |
| Molecular Weight | 222.63 |
| CAS Registry Number | 857226-21-2 |
| SMILES | O=C(NC(NC(=O)C)(C(=O)O)C)CCl |
| InChI | 1S/C7H11ClN2O4/c1-4(11)9-7(2,6(13)14)10-5(12)3-8/h3H2,1-2H3,(H,9,11)(H,10,12)(H,13,14) |
| InChIKey | QUHGPNAKJAJAPQ-UHFFFAOYSA-N |
| Density | 1.374g/cm3 (Cal.) |
|---|---|
| Boiling point | 564.462°C at 760 mmHg (Cal.) |
| Flash point | 295.176°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetamido-N-(chloroacetyl)alanine |