Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | N,N-Diethyl-5-oxo-L-prolinamide |
|---|---|
| Synonyms | (S)-N,N-diethyl-5-oxopyrrolidine-2-carboxamide |
| Molecular Structure |  |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 |
| CAS Registry Number | 85760-88-9 |
| EINECS | 288-566-7 |
| SMILES | O=C(N(CC)CC)[C@@H]1CCC(=O)N1 |
| InChI | 1S/C9H16N2O2/c1-3-11(4-2)9(13)7-5-6-8(12)10-7/h7H,3-6H2,1-2H3,(H,10,12)/t7-/m0/s1 |
| InChIKey | IZCZSKAHNSOBSI-ZETCQYMHSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 394.754°C at 760 mmHg (Cal.) |
| Flash point | 192.541°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Diethyl-5-oxo-L-prolinamide |