|
CAS#: 85769-44-4 Product: 3,4-Dimethoxy-5,8,9,15a-tetrahydro[1,3]dioxolo[4,5-h]isoquinolino[1,2-b][3]benzazepine-6,15-dione No suppilers available for the product. |
| Name | 3,4-Dimethoxy-5,8,9,15a-tetrahydro[1,3]dioxolo[4,5-h]isoquinolino[1,2-b][3]benzazepine-6,15-dione |
|---|---|
| Synonyms | Puntarenine; PUNTARENINE, (±)-; NSC380855 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H19NO6 |
| Molecular Weight | 381.38 |
| CAS Registry Number | 85769-44-4 |
| SMILES | O=C4c2c(cc1OCOc1c2)CCN5C(=O)Cc3c(ccc(OC)c3OC)C45 |
| InChI | 1S/C21H19NO6/c1-25-15-4-3-12-14(21(15)26-2)9-18(23)22-6-5-11-7-16-17(28-10-27-16)8-13(11)20(24)19(12)22/h3-4,7-8,19H,5-6,9-10H2,1-2H3 |
| InChIKey | RIGDPEKYCIWKDD-UHFFFAOYSA-N |
| Density | 1.448g/cm3 (Cal.) |
|---|---|
| Boiling point | 637.292°C at 760 mmHg (Cal.) |
| Flash point | 339.222°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,4-Dimethoxy-5,8,9,15a-tetrahydro[1,3]dioxolo[4,5-h]isoquinolino[1,2-b][3]benzazepine-6,15-dione |