|
CAS#: 85872-58-8 Product: 4-(1,3-Dimethyl-2,6-dioxo-2,3,6,9-tetrahydro-1H-purin-8-yl)benzoic acid No suppilers available for the product. |
| Name | 4-(1,3-Dimethyl-2,6-dioxo-2,3,6,9-tetrahydro-1H-purin-8-yl)benzoic acid |
|---|---|
| Synonyms | 4-(1,3-Di |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N4O4 |
| Molecular Weight | 300.27 |
| CAS Registry Number | 85872-58-8 |
| SMILES | CN1C2=C(C(=O)N(C1=O)C)N=C(N2)C3=CC=C(C=C3)C(=O)O |
| InChI | 1S/C14H12N4O4/c1-17-11-9(12(19)18(2)14(17)22)15-10(16-11)7-3-5-8(6-4-7)13(20)21/h3-6H,1-2H3,(H,15,16)(H,20,21) |
| InChIKey | VOGIMZNURUXDIJ-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 621.9±61.0°C at 760 mmHg (Cal.) |
| Flash point | 329.9±33.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(1,3-Dimethyl-2,6-dioxo-2,3,6,9-tetrahydro-1H-purin-8-yl)benzoic acid |