Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,5-Diacetyl-2-pyrrolidinone |
|---|---|
| Synonyms | 1,1'-(5-oxopyrrolidine-1,2-diyl)diethanone; 2-Pyrrolidinone, 1,5-diacetyl-; NSC280734 |
| Molecular Structure |  |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 |
| CAS Registry Number | 85881-85-2 |
| SMILES | O=C1N(C(=O)C)C(C(=O)C)CC1 |
| InChI | 1S/C8H11NO3/c1-5(10)7-3-4-8(12)9(7)6(2)11/h7H,3-4H2,1-2H3 |
| InChIKey | XHYQSLAIRFZQAS-UHFFFAOYSA-N |
| Density | 1.219g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.941°C at 760 mmHg (Cal.) |
| Flash point | 150.984°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Diacetyl-2-pyrrolidinone |