Online Database of Chemicals from Around the World
|
CAS#: 85959-59-7 Product: 17-Hydroxy-3,11,20-trioxopregna-1,4-dien-21-yl heptanoate No suppilers available for the product. |
| Name | 17-Hydroxy-3,11,20-trioxopregna-1,4-dien-21-yl heptanoate |
|---|---|
| Synonyms | 17,21-dihydroxypregna-1,4-diene-3,11,20-trione 21-heptanoate |
| Molecular Structure |  |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.60 |
| CAS Registry Number | 85959-59-7 |
| EINECS | 289-054-6 |
| SMILES | CCCCCCC(=O)OCC(=O)[C@@]4(O)CC[C@H]3[C@@H]2CCC1=CC(=O)C=C[C@]1(C)[C@H]2C(=O)C[C@@]34C |
| InChI | 1S/C28H38O6/c1-4-5-6-7-8-24(32)34-17-23(31)28(33)14-12-21-20-10-9-18-15-19(29)11-13-26(18,2)25(20)22(30)16-27(21,28)3/h11,13,15,20-21,25,33H,4-10,12,14,16-17H2,1-3H3/t20-,21-,25+,26-,27-,28-/m0/s1 |
| InChIKey | QOCHLIUSCKIIRS-JGCKISFHSA-N |
| Density | 1.2g/cm3 (Cal.) |
|---|---|
| Boiling point | 626.242°C at 760 mmHg (Cal.) |
| Flash point | 203.4°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17-Hydroxy-3,11,20-trioxopregna-1,4-dien-21-yl heptanoate |