Online Database of Chemicals from Around the World
|
CAS#: 85959-67-7 Product: Sodium 2,5-dichloro-4-hydrazinobenzenesulfonate No suppilers available for the product. |
| Name | Sodium 2,5-dichloro-4-hydrazinobenzenesulfonate |
|---|---|
| Synonyms | sodium 2,5-dichloro-4-hydrazinobenzenesulphonate |
| Molecular Structure |  |
| Molecular Formula | C6H5Cl2N2NaO3S |
| Molecular Weight | 279.08 |
| CAS Registry Number | 85959-67-7 |
| EINECS | 289-063-5 |
| SMILES | [Na+].Clc1cc(c(Cl)cc1NN)S([O-])(=O)=O |
| InChI | 1S/C6H6Cl2N2O3S.Na/c7-3-2-6(14(11,12)13)4(8)1-5(3)10-9;/h1-2,10H,9H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | RFVLQKJFRXXZLG-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for Sodium 2,5-dichloro-4-hydrazinobenzenesulfonate |