Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 6-Quinoxalinamine 1,4-dioxide |
|---|---|
| Synonyms | 6-aminoquinoxaline 1,4-dioxide |
| Molecular Structure |  |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 |
| CAS Registry Number | 860672-26-0 |
| SMILES | c1cc2c(cc1N)[n+](cc[n+]2[O-])[O-] |
| InChI | 1S/C8H7N3O2/c9-6-1-2-7-8(5-6)11(13)4-3-10(7)12/h1-5H,9H2 |
| InChIKey | AYDFNPREWWFSBG-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 490.587°C at 760 mmHg (Cal.) |
| Flash point | 250.498°C (Cal.) |
| Refractive index | 1.711 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Quinoxalinamine 1,4-dioxide |