Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Allyl (1R,2S)-2-vinylcyclopropanecarboxylate |
|---|---|
| Synonyms | (1R,2S)-allyl 2-vinylcyclopropanecarboxylate |
| Molecular Structure |  |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 |
| CAS Registry Number | 86133-46-2 |
| SMILES | C=CCOC(=O)[C@@H]1C[C@H]1C=C |
| InChI | 1S/C9H12O2/c1-3-5-11-9(10)8-6-7(8)4-2/h3-4,7-8H,1-2,5-6H2/t7-,8-/m1/s1 |
| InChIKey | FIKFQFXDRCUBEW-HTQZYQBOSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 188.095°C at 760 mmHg (Cal.) |
| Flash point | 57.729°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Allyl (1R,2S)-2-vinylcyclopropanecarboxylate |