|
CAS#: 86190-22-9 Product: L-alpha-Glutamyl-N-{(2S)-3-methyl-2-[(4-nitrophenyl)amino]butanoyl}-L-prolinamide No suppilers available for the product. |
| Name | L-alpha-Glutamyl-N-{(2S)-3-methyl-2-[(4-nitrophenyl)amino]butanoyl}-L-prolinamide |
|---|---|
| Synonyms | Pyro-glu-pro-val-pna; Pyroglutamyl-proly-valine-4-nitroanilide; S 2484 |
| Molecular Structure | ![]() |
| Molecular Formula | C21H29N5O7 |
| Molecular Weight | 463.48 |
| CAS Registry Number | 86190-22-9 |
| SMILES | O=C(NC(=O)[C@@H](Nc1ccc([N+]([O-])=O)cc1)C(C)C)[C@H]2N(C(=O)[C@@H](N)CCC(=O)O)CCC2 |
| InChI | 1S/C21H29N5O7/c1-12(2)18(23-13-5-7-14(8-6-13)26(32)33)20(30)24-19(29)16-4-3-11-25(16)21(31)15(22)9-10-17(27)28/h5-8,12,15-16,18,23H,3-4,9-11,22H2,1-2H3,(H,27,28)(H,24,29,30)/t15-,16-,18-/m0/s1 |
| InChIKey | QVTBYJZQQRTQII-BQFCYCMXSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 773.342°C at 760 mmHg (Cal.) |
| Flash point | 421.502°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-alpha-Glutamyl-N-{(2S)-3-methyl-2-[(4-nitrophenyl)amino]butanoyl}-L-prolinamide |