Online Database of Chemicals from Around the World
|
CAS#: 86248-85-3 Product: L-Tyrosyl-D-alanylglycyl-L-phenylalanyl-O-benzyl-L-serine No suppilers available for the product. |
| Name | L-Tyrosyl-D-alanylglycyl-L-phenylalanyl-O-benzyl-L-serine |
|---|---|
| Synonyms | 2-Ala-O-benzyl-5-ser-enkephalin; Abs-enkephalin; Enkephalin, ala(2)-O-benzyl-ser(5)- |
| Molecular Structure |  |
| Molecular Formula | C33H39N5O8 |
| Molecular Weight | 633.69 |
| CAS Registry Number | 86248-85-3 |
| SMILES | O=C(O)[C@@H](NC(=O)[C@@H](NC(=O)CNC(=O)[C@H](NC(=O)[C@@H](N)Cc1ccc(O)cc1)C)Cc2ccccc2)COCc3ccccc3 |
| InChI | 1S/C33H39N5O8/c1-21(36-31(42)26(34)16-23-12-14-25(39)15-13-23)30(41)35-18-29(40)37-27(17-22-8-4-2-5-9-22)32(43)38-28(33(44)45)20-46-19-24-10-6-3-7-11-24/h2-15,21,26-28,39H,16-20,34H2,1H3,(H,35,41)(H,36,42)(H,37,40)(H,38,43)(H,44,45)/t21-,26+,27+,28+/m1/s1 |
| InChIKey | HVQDXNFVVVKJPV-VKKANWSESA-N |
| Density | 1.302g/cm3 (Cal.) |
|---|---|
| Boiling point | 1051.307°C at 760 mmHg (Cal.) |
| Flash point | 589.609°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for L-Tyrosyl-D-alanylglycyl-L-phenylalanyl-O-benzyl-L-serine |