Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-[(2,3,5-Trichlorophenyl)amino]benzoic acid |
|---|---|
| Synonyms | 2-((2,3,5-trichlorophenyl)amino)benzoic acid |
| Molecular Structure | ![CAS#: 86282-71-5， 2-[(2,3,5-Trichlorophenyl)amino]benzoic acid](/moreStructures/86282-71-5.gif) |
| Molecular Formula | C13H8Cl3NO2 |
| Molecular Weight | 316.57 |
| CAS Registry Number | 86282-71-5 |
| SMILES | c1ccc(c(c1)C(=O)O)Nc2cc(cc(c2Cl)Cl)Cl |
| InChI | 1S/C13H8Cl3NO2/c14-7-5-9(15)12(16)11(6-7)17-10-4-2-1-3-8(10)13(18)19/h1-6,17H,(H,18,19) |
| InChIKey | BZTUQSMAEGRQHD-UHFFFAOYSA-N |
| Density | 1.553g/cm3 (Cal.) |
|---|---|
| Boiling point | 421.325°C at 760 mmHg (Cal.) |
| Flash point | 208.61°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(2,3,5-Trichlorophenyl)amino]benzoic acid |