|
CAS#: 86336-36-9 Product: 3-[2-Nitro-4-(trifluoromethyl)phenoxy]aniline No suppilers available for the product. |
| Name | 3-[2-Nitro-4-(trifluoromethyl)phenoxy]aniline |
|---|---|
| Synonyms | 3-[2-nitro-4-(trifluoromethyl)phenoxy]aniline; NCIOpen2_002594; NSC63334 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9F3N2O3 |
| Molecular Weight | 298.22 |
| CAS Registry Number | 86336-36-9 |
| SMILES | FC(F)(F)c2ccc(Oc1cc(N)ccc1)c(c2)[N+]([O-])=O |
| InChI | 1S/C13H9F3N2O3/c14-13(15,16)8-4-5-12(11(6-8)18(19)20)21-10-3-1-2-9(17)7-10/h1-7H,17H2 |
| InChIKey | GAZRUDPNQMDFNU-UHFFFAOYSA-N |
| Density | 1.436g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.104°C at 760 mmHg (Cal.) |
| Flash point | 175.214°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[2-Nitro-4-(trifluoromethyl)phenoxy]aniline |