|
CAS#: 86386-47-2 Product: 2,4,6-Trinitrophenylglutathione No suppilers available for the product. |
| Name | 2,4,6-Trinitrophenylglutathione |
|---|---|
| Synonyms | 2,4,6-Trinitrophenylglutathione; Tnp-glutathione; Tnp-gsh |
| Molecular Structure | ![]() |
| Molecular Formula | C26H33N9O18S2 |
| Molecular Weight | 823.72 |
| CAS Registry Number | 86386-47-2 |
| SMILES | O=C(N(c1c(cc(cc1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O)CC(=O)O)[C@@H](NC(=O)CC[C@@H](C(=O)O)N)CSSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
| InChI | 1S/C26H33N9O18S2/c27-12(25(44)45)1-3-18(36)30-14(23(42)29-7-20(38)39)9-54-55-10-15(31-19(37)4-2-13(28)26(46)47)24(43)32(8-21(40)41)22-16(34(50)51)5-11(33(48)49)6-17(22)35(52)53/h5-6,12-15H,1-4,7-10,27-28H2,(H,29,42)(H,30,36)(H,31,37)(H,38,39)(H,40,41)(H,44,45)(H,46,47)/t12-,13-,14-,15-/m0/s1 |
| InChIKey | FFQZVOHBBONILO-AJNGGQMLSA-N |
| Density | 1.68g/cm3 (Cal.) |
|---|---|
| Boiling point | 1303.261°C at 760 mmHg (Cal.) |
| Flash point | 741.985°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4,6-Trinitrophenylglutathione |