| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() | www.hoffmanchemicals.com | |||
![]() | +61 3-7003-5401 | |||
![]() | info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 2-Bromo-3-chlorophenyl N,N-diethylcarbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13BrClNO2 |
| Molecular Weight | 306.58 |
| CAS Registry Number | 863870-78-4 |
| SMILES | CCN(CC)C(=O)OC1=C(C(=CC=C1)Cl)Br |
| Solubility | 5.904 mg/L (25 °C water) |
|---|---|
| Density | 1.4±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.553, Calc.* |
| Melting point | 105.13 °C |
| Boiling Point | 330.68 °C, 357.7±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 170.1±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-3-chlorophenyl N,N-diethylcarbamate |