| Hoffman Fine Chemicals Pty Ltd | Australia | Inquire | ||
|---|---|---|---|---|
![]() | www.hoffmanchemicals.com | |||
![]() | +61 3-7003-5401 | |||
![]() | info@hoffmanchemicals.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2023 | ||||
| Name | 2,3-Dibromophenyl N,N-diethylcarbamate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C11H13Br2NO2 |
| Molecular Weight | 351.03 |
| CAS Registry Number | 863870-80-8 |
| SMILES | CCN(CC)C(=O)OC1=C(C(=CC=C1)Br)Br |
| Solubility | 1.98 mg/L (25 °C water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.567, Calc.* |
| Melting point | 111.70 °C |
| Boiling Point | 343.29 °C, 371.0±42.0 °C (760 mmHg), Calc.* |
| Flash Point | 178.2±27.9 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 2,3-Dibromophenyl N,N-diethylcarbamate |