Online Database of Chemicals from Around the World
|
CAS#: 86402-43-9 Product: 2,3,6-Trideoxy-3-methyl-3-nitro-L-ribo-hexose No suppilers available for the product. |
| Name | 2,3,6-Trideoxy-3-methyl-3-nitro-L-ribo-hexose |
|---|---|
| Synonyms | Methyl β-decilonitroside |
| Molecular Structure |  |
| Molecular Formula | C7H13NO5 |
| Molecular Weight | 191.18 |
| CAS Registry Number | 86402-43-9 |
| SMILES | O=CC[C@@]([N+]([O-])=O)([C@@H](O)[C@@H](O)C)C |
| InChI | 1S/C7H13NO5/c1-5(10)6(11)7(2,3-4-9)8(12)13/h4-6,10-11H,3H2,1-2H3/t5-,6-,7+/m0/s1 |
| InChIKey | NXLFZVUAZMYNDL-LYFYHCNISA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.57°C at 760 mmHg (Cal.) |
| Flash point | 169.569°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3,6-Trideoxy-3-methyl-3-nitro-L-ribo-hexose |