|
CAS#: 86408-34-6 Product: 8-(4'-Amino-4-biphenylyl)-2'-deoxyguanosine No suppilers available for the product. |
| Name | 8-(4'-Amino-4-biphenylyl)-2'-deoxyguanosine |
|---|---|
| Synonyms | 8-(4'-Amino(1',1'-biphenyl)-4-yl)-2'-deoxyguanosine; dG-8-Abp; Dguo-8-abp |
| Molecular Structure | ![]() |
| Molecular Formula | C22H22N6O4 |
| Molecular Weight | 434.45 |
| CAS Registry Number | 86408-34-6 |
| SMILES | O=C5/N=C(/N)Nc1c5nc(n1[C@@H]2O[C@@H]([C@@H](O)C2)CO)c4ccc(c3ccc(N)cc3)cc4 |
| InChI | 1S/C22H22N6O4/c23-14-7-5-12(6-8-14)11-1-3-13(4-2-11)19-25-18-20(26-22(24)27-21(18)31)28(19)17-9-15(30)16(10-29)32-17/h1-8,15-17,29-30H,9-10,23H2,(H3,24,26,27,31)/t15-,16+,17+/m0/s1 |
| InChIKey | KHULLEQODFELEK-GVDBMIGSSA-N |
| Density | 1.667g/cm3 (Cal.) |
|---|---|
| Boiling point | 817.796°C at 760 mmHg (Cal.) |
| Flash point | 448.387°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-(4'-Amino-4-biphenylyl)-2'-deoxyguanosine |