|
CAS#: 864685-19-8 Product: Ethyl 1-benzyl-3-(2,2-difluoroethyl)-4-oxo-3-piperidinecarboxylate No suppilers available for the product. |
| Name | Ethyl 1-benzyl-3-(2,2-difluoroethyl)-4-oxo-3-piperidinecarboxylate |
|---|---|
| Synonyms | 3-PIPERID |
| Molecular Structure | ![]() |
| Molecular Formula | C17H21F2NO3 |
| Molecular Weight | 325.35 |
| CAS Registry Number | 864685-19-8 |
| SMILES | CCOC(=O)C2(CN(Cc1ccccc1)CCC2=O)CC(F)F |
| InChI | 1S/C17H21F2NO3/c1-2-23-16(22)17(10-15(18)19)12-20(9-8-14(17)21)11-13-6-4-3-5-7-13/h3-7,15H,2,8-12H2,1H3 |
| InChIKey | BTTAIUJHCWZCRA-UHFFFAOYSA-N |
| Density | 1.189g/cm3 (Cal.) |
|---|---|
| Boiling point | 409.158°C at 760 mmHg (Cal.) |
| Flash point | 201.252°C (Cal.) |
| Refractive index | 1.503 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 1-benzyl-3-(2,2-difluoroethyl)-4-oxo-3-piperidinecarboxylate |